CAS 844879-27-2

(3-bromophenyl)[4-(1-methylethyl)phenyl]methanone

Description:

The chemical substance known as (3-bromophenyl)[4-(1-methylethyl)phenyl]methanone, with the CAS number 844879-27-2, is an organic compound characterized by its complex structure, which includes a brominated phenyl group and a ketone functional group. This compound features a phenyl ring substituted at the 3-position with a bromine atom, enhancing its reactivity and potential applications in various chemical reactions. The presence of the isopropyl group at the para position of another phenyl ring contributes to its steric and electronic properties, which can influence its behavior in chemical processes. As a ketone, it exhibits typical carbonyl reactivity, making it a candidate for nucleophilic addition reactions. The compound's unique structure may also impart specific physical properties, such as solubility and melting point, which are important for its application in fields like pharmaceuticals or materials science. Overall, this compound's characteristics make it a subject of interest for further research and potential applications in synthetic chemistry.

Formula: C₁₆H₁₅BrO

InChI: InChI=1/C16H15BrO/c1-11(2)12-6-8-13(9-7-12)16(18)14-4-3-5-15(17)10-14/h3-11H,1-2H3

SMILES: CC(C)c1ccc(cc1)C(=O)c1cccc(c1)Br

Synonyms:

• (3-Bromophenyl)(4-isopropylphenyl)methanone
• Methanone, (3-bromophenyl)[4-(1-methylethyl)phenyl]-