CAS 844879-29-4

(3-bromophenyl)(4-ethylphenyl)methanone

Description:

(3-bromophenyl)(4-ethylphenyl)methanone, with the CAS number 844879-29-4, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the methanone moiety. This compound features a bromine atom attached to a phenyl ring at the meta position, along with an ethyl group on another phenyl ring at the para position. The presence of the bromine atom contributes to its reactivity and potential applications in various chemical reactions, such as electrophilic aromatic substitution. The ethyl group enhances the hydrophobic character of the molecule, influencing its solubility and interaction with biological systems. This compound may exhibit interesting properties such as fluorescence or photochemical activity, making it of interest in materials science and medicinal chemistry. Its structural features suggest potential applications in the synthesis of more complex organic molecules or as intermediates in pharmaceutical development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₃BrO

InChI: InChI=1/C15H13BrO/c1-2-11-6-8-12(9-7-11)15(17)13-4-3-5-14(16)10-13/h3-10H,2H2,1H3

SMILES: CCc1ccc(cc1)C(=O)c1cccc(c1)Br

Synonyms:

• Methanone, (3-bromophenyl)(4-ethylphenyl)-
• (3-Bromophenyl)(4-ethylphenyl)methanone