CAS 844879-31-8

(3-Bromophenyl)(4-propylphenyl)methanone

Description:

(3-Bromophenyl)(4-propylphenyl)methanone, with the CAS number 844879-31-8, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the methanone moiety. This compound features a bromine atom attached to a phenyl ring at the meta position, along with a propyl group attached to another phenyl ring at the para position. The presence of the bromine atom contributes to its reactivity and potential applications in various chemical reactions, such as electrophilic aromatic substitution. The propyl group enhances the hydrophobic character of the molecule, influencing its solubility and interaction with biological systems. This compound may exhibit interesting properties such as fluorescence or biological activity, making it of interest in fields like medicinal chemistry or materials science. Its structural characteristics suggest potential uses in the synthesis of more complex organic molecules or as a building block in drug development. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values.

Formula: C₁₆H₁₅BrO

InChI: InChI=1S/C16H15BrO/c1-2-4-12-7-9-13(10-8-12)16(18)14-5-3-6-15(17)11-14/h3,5-11H,2,4H2,1H3

InChI key: InChIKey=MBTBVSIVYXHSDB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CCC)C=C2

Synonyms:

• 3-Bromo-4′-n-propylbenzophenone
• Methanone, (3-bromophenyl)(4-propylphenyl)-
• (3-Bromophenyl)(4-propylphenyl)methanone