CymitQuimica logo

CAS 844879-33-0

:

(3-Bromophenyl)(4-butylphenyl)methanone

Description:
(3-Bromophenyl)(4-butylphenyl)methanone, with the CAS number 844879-33-0, is an organic compound characterized by its ketone functional group and the presence of bromine and butyl substituents on the phenyl rings. This compound features a central carbon atom bonded to a ketone group (C=O) and two distinct phenyl groups: one substituted with a bromine atom at the meta position and the other with a butyl group at the para position. The presence of the bromine atom contributes to the compound's reactivity and potential applications in organic synthesis, while the butyl group may influence its solubility and hydrophobic properties. The molecular structure suggests that it may exhibit interesting electronic properties due to the conjugation between the phenyl rings and the carbonyl group. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, this compound may have applications in pharmaceuticals, materials science, or as an intermediate in organic synthesis.
Formula:C17H17BrO
InChI:InChI=1/C17H17BrO/c1-2-3-5-13-8-10-14(11-9-13)17(19)15-6-4-7-16(18)12-15/h4,6-12H,2-3,5H2,1H3
InChI key:InChIKey=WNMIRAAPSOZXCV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CCCC)C=C2
Synonyms:
  • Methanone, (3-bromophenyl)(4-butylphenyl)-
  • (3-Bromophenyl)(4-butylphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.