CAS 844879-39-6

(3-Bromophenyl)(3,4-dichlorophenyl)methanone

Description:

(3-Bromophenyl)(3,4-dichlorophenyl)methanone, with the CAS number 844879-39-6, is an organic compound characterized by its ketone functional group and the presence of multiple halogen substituents. This compound features a central carbonyl group (C=O) bonded to two aromatic rings: one containing a bromine atom and the other containing two chlorine atoms. The presence of these halogens typically influences the compound's reactivity, stability, and solubility, often enhancing its lipophilicity and potential biological activity. The compound may exhibit interesting properties such as antimicrobial or anticancer activities, making it of interest in pharmaceutical research. Additionally, the specific arrangement of the bromine and chlorine substituents can affect the electronic properties of the molecule, potentially altering its interaction with biological targets. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are essential when handling or studying this substance.

Formula: C₁₃H₇BrCl₂O

InChI: InChI=1S/C13H7BrCl2O/c14-10-3-1-2-8(6-10)13(17)9-4-5-11(15)12(16)7-9/h1-7H

InChI key: InChIKey=XFQXEVYYULCMIR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC(Br)=CC=C2

Synonyms:

• Methanone, (3-bromophenyl)(3,4-dichlorophenyl)-
• (3-Bromophenyl)(3,4-dichlorophenyl)methanone