CAS 844879-42-1
:(3-Bromophenyl)(3,5-dichlorophenyl)methanone
Description:
(3-Bromophenyl)(3,5-dichlorophenyl)methanone, with the CAS number 844879-42-1, is an organic compound characterized by its ketone functional group and the presence of multiple halogen substituents on its aromatic rings. This compound features a methanone moiety, where a carbonyl group (C=O) is bonded to two distinct phenyl groups, one of which is substituted with a bromine atom at the meta position, while the other has two chlorine atoms at the 3 and 5 positions. The presence of these halogens typically influences the compound's reactivity, stability, and solubility, often enhancing its electrophilic character. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as halogenated compounds are frequently explored for their biological activity. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the steric and electronic effects of the bromine and chlorine substituents. Overall, this compound exemplifies the complexity and diversity of halogenated organic molecules in chemical synthesis and application.
Formula:C13H7BrCl2O
InChI:InChI=1S/C13H7BrCl2O/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H
InChI key:InChIKey=JFWKNPFGZDOIAI-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC(Br)=CC=C2
Synonyms:- 3-Bromo-3′,5′-dichlorobenzophenone
- Methanone, (3-bromophenyl)(3,5-dichlorophenyl)-
- (3-Bromophenyl)(3,5-dichlorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
