CAS 844879-49-8

(3-Bromophenyl)(3,4-dimethylphenyl)methanone

Description:

(3-Bromophenyl)(3,4-dimethylphenyl)methanone, with the CAS number 844879-49-8, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methanone structure. This compound features a bromine atom attached to a phenyl ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 3,4-dimethylphenyl group enhances its hydrophobic characteristics and may influence its solubility in various organic solvents. The molecular structure suggests that it may exhibit interesting electronic properties due to the substituents on the aromatic rings, which can affect its behavior in chemical reactions. Additionally, the compound may have applications in pharmaceuticals or materials science, given the significance of brominated and methylated aromatic compounds in these fields. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.

Formula: C₁₅H₁₃BrO

InChI: InChI=1S/C15H13BrO/c1-10-6-7-13(8-11(10)2)15(17)12-4-3-5-14(16)9-12/h3-9H,1-2H3

InChI key: InChIKey=OXXRWJCBXMOMTC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=C(C)C=C1)C2=CC(Br)=CC=C2

Synonyms:

• Methanone, (3-bromophenyl)(3,4-dimethylphenyl)-
• (3-Bromophenyl)(3,4-dimethylphenyl)methanone