CAS 844879-52-3

(3-bromophenyl)[4-(ethylsulfanyl)phenyl]methanone

Description:

(3-bromophenyl)[4-(ethylsulfanyl)phenyl]methanone, identified by its CAS number 844879-52-3, is an organic compound characterized by its complex structure, which includes a bromine atom and an ethylsulfanyl group attached to phenyl rings. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The ethylsulfanyl group introduces additional reactivity and can influence the compound's solubility and interaction with biological systems. Typically, compounds of this nature may exhibit interesting biological activities, making them subjects of interest in medicinal chemistry. The molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as building blocks in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₅H₁₃BrOS

InChI: InChI=1/C15H13BrOS/c1-2-18-14-8-6-11(7-9-14)15(17)12-4-3-5-13(16)10-12/h3-10H,2H2,1H3

SMILES: CCSc1ccc(cc1)C(=O)c1cccc(c1)Br

Synonyms:

• Methanone, (3-bromophenyl)[4-(ethylthio)phenyl]-
• (3-Bromophenyl)[4-(ethylsulfanyl)phenyl]methanone