CAS 844882-34-4
:4-[(Diethylamino)methyl]-5-ethyl-2-furancarboxylic acid
Description:
4-[(Diethylamino)methyl]-5-ethyl-2-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring, a carboxylic acid group, and a diethylamino substituent. This compound typically exhibits properties associated with both furan derivatives and amino acids, such as moderate solubility in polar solvents due to the presence of the carboxylic acid group. The diethylamino group contributes to its basicity and potential for forming salts with acids. It may also display biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it could participate in various chemical reactions, including esterification and amidation, due to the reactive functional groups present. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound's characteristics make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C12H19NO3
InChI:InChI=1/C12H19NO3/c1-4-10-9(8-13(5-2)6-3)7-11(16-10)12(14)15/h7H,4-6,8H2,1-3H3,(H,14,15)
InChI key:InChIKey=MMXNBMVJYDEHTF-UHFFFAOYSA-N
SMILES:C(N(CC)CC)C1=C(CC)OC(C(O)=O)=C1
Synonyms:- 2-Furancarboxylic Acid, 4-[(Diethylamino)Methyl]-5-Ethyl-
- 4-[(Diethylamino)methyl]-5-ethyl-2-furancarboxylic acid
- 4-[(Diethylamino)methyl]-5-ethyl-2-furoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.