CAS 844884-92-0
:(3-Chlorophenyl)[4-(1-methylethyl)phenyl]methanone
Description:
(3-Chlorophenyl)[4-(1-methylethyl)phenyl]methanone, with the CAS number 844884-92-0, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a chlorinated phenyl group and an isopropyl-substituted phenyl group, contributing to its unique chemical properties. The presence of the chlorine atom enhances its reactivity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to its extensive aromatic system, which can affect its solubility in organic solvents and its interaction with biological membranes. Additionally, the steric hindrance introduced by the isopropyl group may impact its reactivity and binding affinity in biological systems. Overall, this compound's structural characteristics suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C16H15ClO
InChI:InChI=1S/C16H15ClO/c1-11(2)12-6-8-13(9-7-12)16(18)14-4-3-5-15(17)10-14/h3-11H,1-2H3
InChI key:InChIKey=LLFNHKJZEPGSOD-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C(C)C)C=C1)C2=CC(Cl)=CC=C2
Synonyms:- (3-Chlorophenyl)(4-isopropylphenyl)methanone
- Methanone, (3-chlorophenyl)[4-(1-methylethyl)phenyl]-
- (3-Chlorophenyl)[4-(1-methylethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.