CAS 844884-93-1

(4-Butylphenyl)(3-chlorophenyl)methanone

Description:

(4-Butylphenyl)(3-chlorophenyl)methanone, with the CAS number 844884-93-1, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to two aromatic rings. The presence of a butyl group on one phenyl ring and a chlorine substituent on the other phenyl ring contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the hydrophobic nature of the butyl group and the aromatic systems, which can influence its solubility in organic solvents. The chlorine atom can introduce additional reactivity, potentially participating in electrophilic aromatic substitution reactions. The compound may also exhibit interesting photophysical properties, making it relevant in fields such as materials science or organic synthesis. Its stability and reactivity can be influenced by the steric and electronic effects of the substituents, which may affect its applications in various chemical processes or as an intermediate in the synthesis of more complex molecules.

Formula: C₁₇H₁₇ClO

InChI: InChI=1/C17H17ClO/c1-2-3-5-13-8-10-14(11-9-13)17(19)15-6-4-7-16(18)12-15/h4,6-12H,2-3,5H2,1H3

InChI key: InChIKey=LRYZHEFMNVCFBH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CCCC)C=C2

Synonyms:

• Methanone, (4-butylphenyl)(3-chlorophenyl)-
• (4-Butylphenyl)(3-chlorophenyl)methanone