CAS 844884-95-3

(3-Chlorophenyl)(3,5-dichlorophenyl)methanone

Description:

(3-Chlorophenyl)(3,5-dichlorophenyl)methanone, identified by its CAS number 844884-95-3, is an organic compound characterized by its ketone functional group and the presence of multiple chlorine substituents on the phenyl rings. This compound features a central carbon atom bonded to a carbonyl group (C=O) and two distinct phenyl groups, one of which has a chlorine atom at the meta position and the other has two chlorine atoms at the 3 and 5 positions. The presence of chlorine atoms enhances the compound's lipophilicity and may influence its reactivity and biological activity. Typically, such chlorinated aromatic compounds exhibit significant stability due to the resonance stabilization provided by the aromatic rings. They may also possess interesting pharmacological properties, making them of interest in medicinal chemistry. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular structure and the interactions between its functional groups. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated organic compounds.

Formula: C₁₃H₇Cl₃O

InChI: InChI=1S/C13H7Cl3O/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H

InChI key: InChIKey=XAUIVVKXAFICGX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC(Cl)=CC=C2

Synonyms:

• Methanone, (3-chlorophenyl)(3,5-dichlorophenyl)-
• (3-Chlorophenyl)(3,5-dichlorophenyl)methanone