CAS 844884-96-4
:(3-chloro-5-fluorophenyl)(3-chlorophenyl)methanone
Description:
(3-chloro-5-fluorophenyl)(3-chlorophenyl)methanone, with the CAS number 844884-96-4, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety, and is substituted with two distinct aromatic rings. One ring contains both chlorine and fluorine substituents, while the other ring has a chlorine substituent. This substitution pattern can influence the compound's reactivity, stability, and potential biological activity. The presence of halogens, such as chlorine and fluorine, often enhances lipophilicity and can affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such halogenated compounds are frequently explored for their unique properties. Overall, (3-chloro-5-fluorophenyl)(3-chlorophenyl)methanone exemplifies the diverse chemistry associated with halogenated aromatic compounds.
Formula:C13H7Cl2FO
InChI:InChI=1/C13H7Cl2FO/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H
SMILES:c1cc(cc(c1)Cl)C(=O)c1cc(cc(c1)F)Cl
Synonyms:- Methanone, (3-chloro-5-fluorophenyl)(3-chlorophenyl)-
- (3-Chloro-5-fluorophenyl)(3-chlorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.