CymitQuimica logo

CAS 844884-97-5

:

(3-chlorophenyl)(3,4-dimethylphenyl)methanone

Description:
(3-chlorophenyl)(3,4-dimethylphenyl)methanone, with the CAS number 844884-97-5, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methanone structure. This compound features two aromatic rings: one containing a chlorine substituent at the para position and the other with two methyl groups at the meta and para positions. The presence of these substituents influences its chemical properties, such as reactivity and solubility. Generally, compounds like this may exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their biological activity and interactions in various environments. Additionally, the chlorine atom can enhance the compound's electrophilicity, making it more reactive in certain chemical reactions. The compound may be of interest in pharmaceutical research or organic synthesis, where its unique structure could lead to the development of novel materials or therapeutic agents. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C15H13ClO
InChI:InChI=1/C15H13ClO/c1-10-6-7-13(8-11(10)2)15(17)12-4-3-5-14(16)9-12/h3-9H,1-2H3
SMILES:Cc1ccc(cc1C)C(=O)c1cccc(c1)Cl
Synonyms:
  • Methanone, (3-chlorophenyl)(3,4-dimethylphenyl)-
  • (3-Chlorophenyl)(3,4-dimethylphenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.