CAS 844884-98-6
:(3-Chlorophenyl)(3,5-dimethylphenyl)methanone
Description:
(3-Chlorophenyl)(3,5-dimethylphenyl)methanone, with the CAS number 844884-98-6, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to two aromatic rings. The presence of a chlorine atom on one of the phenyl rings contributes to its reactivity and potential biological activity. The two phenyl groups, one being a 3-chlorophenyl and the other a 3,5-dimethylphenyl, provide significant steric hindrance and electronic effects, which can influence the compound's chemical behavior and interactions. This compound may exhibit properties such as lipophilicity due to its aromatic structure, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of substituents like chlorine and methyl groups can affect its solubility, stability, and reactivity. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks or environmental hazards.
Formula:C15H13ClO
InChI:InChI=1S/C15H13ClO/c1-10-6-11(2)8-13(7-10)15(17)12-4-3-5-14(16)9-12/h3-9H,1-2H3
InChI key:InChIKey=OCPWBOXLLXYQCF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=CC(C)=C1)C2=CC(Cl)=CC=C2
Synonyms:- Methanone, (3-chlorophenyl)(3,5-dimethylphenyl)-
- (3-Chlorophenyl)(3,5-dimethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.