CAS 844884-99-7

(3-chlorophenyl)[4-(ethylsulfanyl)phenyl]methanone

Description:

(3-chlorophenyl)[4-(ethylsulfanyl)phenyl]methanone, with the CAS number 844884-99-7, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of a chlorine atom on one of the phenyl rings contributes to its electronic properties, potentially influencing its reactivity and interactions with other molecules. The ethylsulfanyl group introduces a sulfur atom into the structure, which can enhance the compound's solubility in organic solvents and may also affect its biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic systems, making it suitable for various applications in medicinal chemistry and material science. Its unique combination of functional groups may also provide opportunities for further chemical modifications, potentially leading to derivatives with enhanced properties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine and sulfur, which can pose health risks.

Formula: C₁₅H₁₃ClOS

InChI: InChI=1/C15H13ClOS/c1-2-18-14-8-6-11(7-9-14)15(17)12-4-3-5-13(16)10-12/h3-10H,2H2,1H3

SMILES: CCSc1ccc(cc1)C(=O)c1cccc(c1)Cl

Synonyms:

• Methanone, (3-chlorophenyl)[4-(ethylthio)phenyl]-
• (3-Chlorophenyl)[4-(ethylsulfanyl)phenyl]methanone