CAS 844885-02-5

(3-chloro-5-fluorophenyl)(4-chlorophenyl)methanone

Description:

(3-chloro-5-fluorophenyl)(4-chlorophenyl)methanone, with the CAS number 844885-02-5, is an organic compound characterized by its distinct functional groups and aromatic structure. It features a ketone functional group, indicated by the presence of the methanone moiety, which is attached to two phenyl rings. One of the phenyl rings is substituted with both a chlorine and a fluorine atom, contributing to its unique reactivity and potential biological activity. The presence of halogens, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of the compound, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens. Additionally, its potential applications could span various fields, including medicinal chemistry and materials science, where such substituted phenyl ketones are often explored for their biological activities or as intermediates in synthetic pathways. Overall, this compound exemplifies the complexity and utility of halogenated aromatic compounds in chemical research.

Formula: C₁₃H₇Cl₂FO

InChI: InChI=1/C13H7Cl2FO/c14-10-3-1-8(2-4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H

SMILES: c1cc(ccc1C(=O)c1cc(cc(c1)F)Cl)Cl

Synonyms:

• Methanone, (3-chloro-5-fluorophenyl)(4-chlorophenyl)-
• (3-Chloro-5-fluorophenyl)(4-chlorophenyl)methanone