CAS 844885-06-9
:(3,5-difluorophenyl)(3-methylphenyl)methanone
Description:
(3,5-Difluorophenyl)(3-methylphenyl)methanone, with the CAS number 844885-06-9, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methanone structure. This compound features a phenyl ring substituted with two fluorine atoms at the 3 and 5 positions, enhancing its reactivity and potentially influencing its electronic properties. Additionally, it has a 3-methylphenyl group, which introduces a methyl substituent that can affect steric hindrance and solubility. The presence of fluorine atoms typically increases the lipophilicity and can enhance the compound's biological activity, making it of interest in pharmaceutical research. The compound is likely to exhibit moderate stability under standard conditions, but its reactivity can vary depending on the presence of other functional groups or environmental factors. Overall, (3,5-difluorophenyl)(3-methylphenyl)methanone is a compound of interest in organic synthesis and medicinal chemistry due to its unique structural features and potential applications.
Formula:C14H10F2O
InChI:InChI=1/C14H10F2O/c1-9-3-2-4-10(5-9)14(17)11-6-12(15)8-13(16)7-11/h2-8H,1H3
SMILES:Cc1cccc(c1)C(=O)c1cc(cc(c1)F)F
Synonyms:- Methanone, (3,5-difluorophenyl)(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.