CAS 844885-07-0

(3,5-Difluorophenyl)(4-methylphenyl)methanone

Description:

(3,5-Difluorophenyl)(4-methylphenyl)methanone, with the CAS number 844885-07-0, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methanone structure. This compound features a difluorophenyl group, which indicates the presence of two fluorine atoms substituted at the 3 and 5 positions of a phenyl ring, enhancing its reactivity and influencing its electronic properties. Additionally, it contains a para-methylphenyl group, which contributes to the overall hydrophobic character of the molecule. The presence of fluorine atoms typically increases the lipophilicity and may affect the compound's biological activity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex organic molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment.

Formula: C₁₄H₁₀F₂O

InChI: InChI=1S/C14H10F2O/c1-9-2-4-10(5-3-9)14(17)11-6-12(15)8-13(16)7-11/h2-8H,1H3

InChI key: InChIKey=QIZSUGMQKHHAJH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(C)C=C2

Synonyms:

• Methanone, (3,5-difluorophenyl)(4-methylphenyl)-
• (3,5-Difluorophenyl)(4-methylphenyl)methanone