CAS 844885-08-1
:(3,5-Difluorophenyl)(3-methoxyphenyl)methanone
Description:
(3,5-Difluorophenyl)(3-methoxyphenyl)methanone, identified by its CAS number 844885-08-1, is an organic compound characterized by its unique structure, which includes a ketone functional group attached to two aromatic rings. The presence of fluorine atoms on the 3 and 5 positions of the phenyl ring enhances its electronic properties, potentially increasing its reactivity and influencing its interactions in biological systems. The methoxy group on the second phenyl ring contributes to its solubility and can affect its pharmacokinetic properties. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular weight, melting point, and solubility characteristics would typically be determined through experimental methods, and its stability can be influenced by environmental factors such as temperature and pH. Overall, (3,5-Difluorophenyl)(3-methoxyphenyl)methanone represents a versatile scaffold for further chemical modifications and potential applications in drug development.
Formula:C14H10F2O2
InChI:InChI=1S/C14H10F2O2/c1-18-13-4-2-3-9(7-13)14(17)10-5-11(15)8-12(16)6-10/h2-8H,1H3
InChI key:InChIKey=XVVVWKDQMBERMO-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=CC(F)=C1)C2=CC(OC)=CC=C2
Synonyms:- 3,5-Difluoro-3′-methoxybenzophenone
- Methanone, (3,5-difluorophenyl)(3-methoxyphenyl)-
- (3,5-Difluorophenyl)(3-methoxyphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.