CAS 844885-09-2

(3,5-Difluorophenyl)[4-(1-methylethyl)phenyl]methanone

Description:

(3,5-Difluorophenyl)[4-(1-methylethyl)phenyl]methanone, with the CAS number 844885-09-2, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of a phenyl ring substituted with two fluorine atoms at the 3 and 5 positions, enhancing its electronic properties and potentially influencing its reactivity. The presence of an isopropyl group on another phenyl ring contributes to its steric bulk, which can affect its interactions in biological systems or chemical reactions. The overall molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance potency or selectivity. Additionally, the fluorine substituents may improve lipophilicity and metabolic stability. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the substance. Understanding these characteristics is crucial for its application in various fields, including medicinal chemistry and materials science.

Formula: C₁₆H₁₄F₂O

InChI: InChI=1S/C16H14F2O/c1-10(2)11-3-5-12(6-4-11)16(19)13-7-14(17)9-15(18)8-13/h3-10H,1-2H3

InChI key: InChIKey=AUDRLTIGZMBSTR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(C(C)C)C=C2

Synonyms:

• (3,5-Difluorophenyl)(4-isopropylphenyl)methanone
• Methanone, (3,5-difluorophenyl)[4-(1-methylethyl)phenyl]-
• (3,5-Difluorophenyl)[4-(1-methylethyl)phenyl]methanone

3,5-Difluoro-4′-iso-propylbenzophenone

CAS: 844885-09-2

Formula: C₁₆H₁₄F₂O

Purity: 97.0%

Molecular weight: 260.284

Ref: 10-F022751