CAS 844885-13-8

(4-butylphenyl)(3,5-difluorophenyl)methanone

Description:

(4-butylphenyl)(3,5-difluorophenyl)methanone, with the CAS number 844885-13-8, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a butyl group attached to a phenyl ring, providing hydrophobic characteristics, while the presence of the 3,5-difluorophenyl moiety introduces electronegative fluorine atoms that can influence its reactivity and polarity. The molecular structure suggests potential applications in various fields, including pharmaceuticals and materials science, due to the unique combination of hydrophobic and polar characteristics. The presence of fluorine atoms often enhances the compound's stability and lipophilicity, which can be advantageous in drug design. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic rings and the carbonyl group. Overall, (4-butylphenyl)(3,5-difluorophenyl)methanone is a versatile compound with potential utility in synthetic chemistry and material applications.

Formula: C₁₇H₁₆F₂O

InChI: InChI=1/C17H16F2O/c1-2-3-4-12-5-7-13(8-6-12)17(20)14-9-15(18)11-16(19)10-14/h5-11H,2-4H2,1H3

SMILES: CCCCc1ccc(cc1)C(=O)c1cc(cc(c1)F)F

Synonyms:

• Methanone, (4-butylphenyl)(3,5-difluorophenyl)-
• (4-Butylphenyl)(3,5-difluorophenyl)methanone

4-Butyl-3',5'-difluorobenzophenone

CAS: 844885-13-8

4-Butyl-3',5'-difluorobenzophenone

Purity: 97%

Molecular weight: 274.31g/mol

Ref: 54-PC2491