CAS 844885-14-9

(3,5-difluorophenyl)(3-fluoro-4-methoxyphenyl)methanone

Description:

(3,5-Difluorophenyl)(3-fluoro-4-methoxyphenyl)methanone, identified by its CAS number 844885-14-9, is an organic compound characterized by its complex aromatic structure. This compound features two aromatic rings, one of which is substituted with two fluorine atoms at the 3 and 5 positions, while the other ring has a fluorine atom at the 3 position and a methoxy group (-OCH3) at the 4 position. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. The methanone functional group (ketone) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic attacks. The fluorine atoms enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and material science. Overall, this compound's unique structure and substituent effects make it a subject of interest for further research and application in various fields.

Formula: C₁₄H₉F₃O₂

InChI: InChI=1/C14H9F3O2/c1-19-13-3-2-8(6-12(13)17)14(18)9-4-10(15)7-11(16)5-9/h2-7H,1H3

SMILES: COc1ccc(cc1F)C(=O)c1cc(cc(c1)F)F

Synonyms:

• Methanone, (3,5-difluorophenyl)(3-fluoro-4-methoxyphenyl)-