CymitQuimica logo

CAS 844885-17-2

:

(3,5-dichlorophenyl)(3,5-difluorophenyl)methanone

Description:
(3,5-Dichlorophenyl)(3,5-difluorophenyl)methanone, with the CAS number 844885-17-2, is an organic compound characterized by its complex aromatic structure. It features two phenyl rings, one substituted with chlorine atoms and the other with fluorine atoms, both located at the 3 and 5 positions, which significantly influence its chemical properties and reactivity. The presence of these halogen substituents typically enhances the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. The ketone functional group (methanone) contributes to its reactivity, allowing for potential interactions in various chemical reactions, such as nucleophilic additions. This compound may exhibit unique physical properties, including solubility in organic solvents and varying melting and boiling points, depending on the specific molecular interactions. Its synthesis and applications could be relevant in fields such as medicinal chemistry, agrochemicals, or materials science, where halogenated compounds are often explored for their diverse functionalities.
Formula:C13H6Cl2F2O
InChI:InChI=1/C13H6Cl2F2O/c14-9-1-7(2-10(15)5-9)13(18)8-3-11(16)6-12(17)4-8/h1-6H
SMILES:c1c(cc(cc1Cl)Cl)C(=O)c1cc(cc(c1)F)F
Synonyms:
  • Methanone, (3,5-dichlorophenyl)(3,5-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.