CymitQuimica logo

CAS 844885-18-3

:

(3-chloro-5-fluorophenyl)(3,5-difluorophenyl)methanone

Description:
The chemical substance known as (3-chloro-5-fluorophenyl)(3,5-difluorophenyl)methanone, with the CAS number 844885-18-3, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety, and is substituted with multiple halogen atoms, specifically chlorine and fluorine. These substitutions can significantly influence the compound's reactivity, polarity, and overall chemical behavior. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of the compound, making it of interest in pharmaceutical applications. Additionally, the chlorinated and fluorinated aromatic rings contribute to the compound's potential as a building block in the synthesis of more complex molecules. The compound's unique structure may also impart specific biological activities, making it a candidate for further research in medicinal chemistry. Overall, this substance exemplifies the intricate interplay between molecular structure and chemical properties in organic compounds.
Formula:C13H6ClF3O
InChI:InChI=1/C13H6ClF3O/c14-9-1-7(2-10(15)5-9)13(18)8-3-11(16)6-12(17)4-8/h1-6H
SMILES:c1c(cc(cc1Cl)F)C(=O)c1cc(cc(c1)F)F
Synonyms:
  • Methanone, (3-chloro-5-fluorophenyl)(3,5-difluorophenyl)-
  • (3-Chloro-5-fluorophenyl)(3,5-difluorophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.