CAS 844885-20-7

(3,5-Difluorophenyl)(4-methoxy-3,5-dimethylphenyl)methanone

Description:

(3,5-Difluorophenyl)(4-methoxy-3,5-dimethylphenyl)methanone, with the CAS number 844885-20-7, is an organic compound characterized by its complex structure featuring a ketone functional group. This substance consists of two aromatic rings: one bearing two fluorine substituents and the other containing a methoxy group and two methyl groups. The presence of fluorine atoms typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methoxy group can also affect the electronic properties of the molecule, potentially altering its reactivity and interaction with biological targets. Additionally, the dimethyl substitutions can provide steric hindrance, which may impact the compound's conformation and overall stability. Overall, this compound's unique combination of functional groups and substituents suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₁₆H₁₄F₂O₂

InChI: InChI=1S/C16H14F2O2/c1-9-4-11(5-10(2)16(9)20-3)15(19)12-6-13(17)8-14(18)7-12/h4-8H,1-3H3

InChI key: InChIKey=XBJVPLMNDRITGS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=C(OC)C(C)=C1)C2=CC(F)=CC(F)=C2

Synonyms:

• Methanone, (3,5-difluorophenyl)(4-methoxy-3,5-dimethylphenyl)-
• (3,5-Difluorophenyl)(4-methoxy-3,5-dimethylphenyl)methanone