CAS 844885-25-2
:(3,4-Dichlorophenyl)(3-methoxyphenyl)methanone
Description:
(3,4-Dichlorophenyl)(3-methoxyphenyl)methanone, identified by its CAS number 844885-25-2, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety, and is substituted with two distinct phenyl groups: one bearing two chlorine atoms at the 3 and 4 positions and the other containing a methoxy group at the 3 position. This compound is likely to exhibit properties typical of aromatic ketones, such as stability and potential reactivity in electrophilic substitution reactions. The presence of chlorine substituents can enhance its lipophilicity and influence its biological activity, while the methoxy group may contribute to its electronic properties. As with many organic compounds, its solubility, melting point, and boiling point would depend on the specific interactions between its molecular structure and the solvent or environment. Overall, this compound may have applications in pharmaceuticals or materials science, although specific uses would depend on further research and characterization.
Formula:C14H10Cl2O2
InChI:InChI=1S/C14H10Cl2O2/c1-18-11-4-2-3-9(7-11)14(17)10-5-6-12(15)13(16)8-10/h2-8H,1H3
InChI key:InChIKey=IPGJDBBWKZKVEQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC(OC)=CC=C2
Synonyms:- (3,4-Dichlorophenyl)(3-methoxyphenyl)methanone
- Methanone, (3,4-dichlorophenyl)(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.