CAS 844885-26-3

(3,4-Dichlorophenyl)[4-(1-methylethyl)phenyl]methanone

Description:

(3,4-Dichlorophenyl)[4-(1-methylethyl)phenyl]methanone, identified by its CAS number 844885-26-3, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and an isopropyl-substituted phenyl group attached to a carbonyl moiety. This compound typically exhibits properties common to ketones, such as being a solid at room temperature with potential solubility in organic solvents. Its molecular structure suggests it may have significant lipophilicity, which can influence its biological activity and interactions. The presence of chlorine atoms in the aromatic ring can enhance its reactivity and may also affect its pharmacokinetic properties, such as absorption and metabolism. Additionally, the compound may exhibit specific optical and electronic properties due to its conjugated system, making it of interest in various fields, including pharmaceuticals and materials science. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₆H₁₄Cl₂O

InChI: InChI=1S/C16H14Cl2O/c1-10(2)11-3-5-12(6-4-11)16(19)13-7-8-14(17)15(18)9-13/h3-10H,1-2H3

InChI key: InChIKey=MFPLPBSZEBSIFM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(C(C)C)C=C2

Synonyms:

• (3,4-Dichlorophenyl)(4-isopropylphenyl)methanone
• Methanone, (3,4-dichlorophenyl)[4-(1-methylethyl)phenyl]-
• (3,4-Dichlorophenyl)[4-(1-methylethyl)phenyl]methanone