CAS 844885-27-4

(3,4-Dichlorophenyl)[4-(1,1-dimethylethyl)phenyl]methanone

Description:

(3,4-Dichlorophenyl)[4-(1,1-dimethylethyl)phenyl]methanone, with the CAS number 844885-27-4, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound contains a dichlorophenyl group, which contributes to its potential reactivity and biological activity, as halogenated phenyl groups often exhibit unique properties in chemical reactions and interactions. The presence of a tert-butyl group (1,1-dimethylethyl) enhances its hydrophobic characteristics, influencing its solubility and stability in various solvents. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. Its molecular structure suggests that it could interact with biological targets, making it a candidate for further investigation in drug discovery. Additionally, the presence of chlorine atoms may impart specific electronic properties, affecting its reactivity and interaction with other chemical species. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific fields.

Formula: C₁₇H₁₆Cl₂O

InChI: InChI=1S/C17H16Cl2O/c1-17(2,3)13-7-4-11(5-8-13)16(20)12-6-9-14(18)15(19)10-12/h4-10H,1-3H3

InChI key: InChIKey=ULTYSFFNLFOUMV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• (3,4-Dichlorophenyl)[4-(1,1-dimethylethyl)phenyl]methanone
• Methanone, (3,4-dichlorophenyl)[4-(1,1-dimethylethyl)phenyl]-