CAS 844885-28-5
:(3,4-dichlorophenyl)(4-ethylphenyl)methanone
Description:
(3,4-Dichlorophenyl)(4-ethylphenyl)methanone, with the CAS number 844885-28-5, is an organic compound characterized by its ketone functional group, specifically a methanone structure where a carbonyl group is bonded to two aromatic rings. The presence of the dichlorophenyl group indicates that two chlorine atoms are substituted on the phenyl ring at the 3 and 4 positions, which can influence the compound's reactivity and physical properties. The 4-ethylphenyl group adds an ethyl substituent to another phenyl ring, contributing to the compound's overall hydrophobic character. This compound may exhibit properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in various fields, including pharmaceuticals and materials science. Its molecular structure suggests potential applications in synthesis and as an intermediate in chemical reactions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C15H12Cl2O
InChI:InChI=1/C15H12Cl2O/c1-2-10-3-5-11(6-4-10)15(18)12-7-8-13(16)14(17)9-12/h3-9H,2H2,1H3
SMILES:CCc1ccc(cc1)C(=O)c1ccc(c(c1)Cl)Cl
Synonyms:- Methanone, (3,4-dichlorophenyl)(4-ethylphenyl)-
- (3,4-Dichlorophenyl)(4-ethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.