CAS 844885-29-6
:(3,4-dichlorophenyl)(4-propylphenyl)methanone
Description:
(3,4-Dichlorophenyl)(4-propylphenyl)methanone, identified by its CAS number 844885-29-6, is an organic compound characterized by its ketone functional group, specifically a methanone structure where a carbonyl group is bonded to two distinct aromatic rings. The presence of the dichlorophenyl group indicates that two chlorine atoms are substituted on the phenyl ring at the 3 and 4 positions, contributing to its potential reactivity and biological activity. The 4-propylphenyl group adds a propyl substituent to another phenyl ring, which can influence the compound's solubility and lipophilicity. This compound may exhibit interesting properties such as potential antimicrobial or anticancer activities, typical of many substituted phenyl ketones. Its molecular structure suggests that it could participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition, making it a candidate for further research in medicinal chemistry and material science. Safety and handling precautions should be observed due to the presence of chlorine substituents, which can pose health risks.
Formula:C16H14Cl2O
InChI:InChI=1/C16H14Cl2O/c1-2-3-11-4-6-12(7-5-11)16(19)13-8-9-14(17)15(18)10-13/h4-10H,2-3H2,1H3
SMILES:CCCc1ccc(cc1)C(=O)c1ccc(c(c1)Cl)Cl
Synonyms:- Methanone, (3,4-dichlorophenyl)(4-propylphenyl)-
- (3,4-Dichlorophenyl)(4-propylphenyl)methanone
- 3,4-DICHLORO-4'-N-PROPYLBENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.