CAS 844885-30-9

(4-Butylphenyl)(3,4-dichlorophenyl)methanone

Description:

(4-Butylphenyl)(3,4-dichlorophenyl)methanone, with the CAS number 844885-30-9, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to two distinct aromatic rings. The presence of the butyl group on one phenyl ring contributes to its hydrophobic characteristics, while the dichlorophenyl moiety introduces electron-withdrawing chlorine substituents, which can influence the compound's reactivity and stability. This compound may exhibit properties typical of ketones, such as being a potential solvent or intermediate in organic synthesis. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic additions or substitutions, depending on the conditions. Additionally, the presence of chlorine atoms may impart unique biological activities or enhance the compound's utility in pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure routes.

Formula: C₁₇H₁₆Cl₂O

InChI: InChI=1S/C17H16Cl2O/c1-2-3-4-12-5-7-13(8-6-12)17(20)14-9-10-15(18)16(19)11-14/h5-11H,2-4H2,1H3

InChI key: InChIKey=UVZCNZSQWZEZMX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(CCCC)C=C2

Synonyms:

• Methanone, (4-butylphenyl)(3,4-dichlorophenyl)-
• (4-Butylphenyl)(3,4-dichlorophenyl)methanone