CAS 844885-31-0

(3,4-Dichlorophenyl)(3,4-difluorophenyl)methanone

Description:

(3,4-Dichlorophenyl)(3,4-difluorophenyl)methanone, with the CAS number 844885-31-0, is an organic compound characterized by its complex aromatic structure. It features two phenyl rings, one substituted with chlorine atoms and the other with fluorine atoms, attached to a central carbonyl group (C=O). This compound is typically a solid at room temperature and exhibits properties common to halogenated aromatic ketones, such as potential biological activity and stability under various conditions. The presence of both chlorine and fluorine substituents can influence its reactivity, solubility, and interaction with biological systems, making it of interest in medicinal chemistry and material science. Additionally, the specific arrangement of the substituents can affect the compound's electronic properties and steric hindrance, which are crucial for its potential applications in pharmaceuticals or agrochemicals. Safety data and handling precautions should be considered due to the presence of halogens, which can pose environmental and health risks.

Formula: C₁₃H₆Cl₂F₂O

InChI: InChI=1/C13H6Cl2F2O/c14-9-3-1-7(5-10(9)15)13(18)8-2-4-11(16)12(17)6-8/h1-6H

InChI key: InChIKey=HQJWUFQWYPSNRV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC(F)=C(F)C=C2

Synonyms:

• Methanone, (3,4-dichlorophenyl)(3,4-difluorophenyl)-
• (3,4-Dichlorophenyl)(3,4-difluorophenyl)methanone
• 3,4-DICHLORO-3',4'-DIFLUOROBENZOPHENONE
• 3,4-Dichloro-3′,4′-difluorobenzophenone, CAS 844885-31-0