CAS 844885-33-2

(3-Chloro-5-fluorophenyl)(3,4-dichlorophenyl)methanone

Description:

(3-Chloro-5-fluorophenyl)(3,4-dichlorophenyl)methanone, with the CAS number 844885-33-2, is a synthetic organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of multiple halogen substituents, specifically chlorine and fluorine, suggests that this compound may exhibit unique electronic properties, influencing its behavior in chemical reactions and interactions with biological systems. The chlorinated and fluorinated aromatic rings can enhance lipophilicity, potentially affecting the compound's solubility and permeability in various environments. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with halogenated aromatic compounds. Additionally, its structural characteristics may allow for further derivatization, making it a valuable intermediate in the synthesis of more complex molecules. As with any chemical substance, safety and handling precautions should be observed, given the potential hazards associated with halogenated compounds.

Formula: C₁₃H₆Cl₃FO

InChI: InChI=1S/C13H6Cl3FO/c14-9-3-8(4-10(17)6-9)13(18)7-1-2-11(15)12(16)5-7/h1-6H

InChI key: InChIKey=RLKQDGGKBDSEHK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(F)=C1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• Methanone, (3-chloro-5-fluorophenyl)(3,4-dichlorophenyl)-
• (3-Chloro-5-fluorophenyl)(3,4-dichlorophenyl)methanone