CAS 844885-35-4

(3,4-dichlorophenyl)(3,5-dimethylphenyl)methanone

Description:

(3,4-Dichlorophenyl)(3,5-dimethylphenyl)methanone, identified by its CAS number 844885-35-4, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features two aromatic rings: one substituted with two chlorine atoms at the 3 and 4 positions, and the other with two methyl groups at the 3 and 5 positions. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The dichlorophenyl group can enhance the compound's lipophilicity, potentially affecting its interaction with biological membranes. Additionally, the steric effects of the methyl groups can influence the compound's conformation and reactivity. Overall, (3,4-dichlorophenyl)(3,5-dimethylphenyl)methanone is a complex molecule with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₅H₁₂Cl₂O

InChI: InChI=1/C15H12Cl2O/c1-9-5-10(2)7-12(6-9)15(18)11-3-4-13(16)14(17)8-11/h3-8H,1-2H3

SMILES: Cc1cc(C)cc(c1)C(=O)c1ccc(c(c1)Cl)Cl

Synonyms:

• Methanone, (3,4-dichlorophenyl)(3,5-dimethylphenyl)-