CAS 844885-36-5

(3,4-Dichlorophenyl)[4-(ethylthio)phenyl]methanone

Description:

(3,4-Dichlorophenyl)[4-(ethylthio)phenyl]methanone, with the CAS number 844885-36-5, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and an ethylthio-substituted phenyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The ethylthio group can also impart unique electronic and steric properties, affecting the compound's solubility and interaction with biological targets. In terms of physical properties, it is likely to be a solid at room temperature, with moderate solubility in organic solvents. Its synthesis and application may be relevant in the development of pharmaceuticals or agrochemicals, where such structural motifs are often explored for their potential therapeutic effects. Safety and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₁₅H₁₂Cl₂OS

InChI: InChI=1S/C15H12Cl2OS/c1-2-19-12-6-3-10(4-7-12)15(18)11-5-8-13(16)14(17)9-11/h3-9H,2H2,1H3

InChI key: InChIKey=MJNDCZPCLPCXOC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(SCC)C=C2

Synonyms:

• (3,4-Dichlorophenyl)[4-(ethylthio)phenyl]methanone
• Methanone, (3,4-dichlorophenyl)[4-(ethylthio)phenyl]-

3,4-Dichloro-4′-(ethylthio)benzophenone

CAS: 844885-36-5

Formula: C₁₅H₁₂Cl₂OS

Purity: 97.0%

Molecular weight: 311.22

Ref: 10-F022785