CAS 844885-37-6
:(3,4-dichlorophenyl)(3-fluoro-4-methoxyphenyl)methanone
Description:
(3,4-Dichlorophenyl)(3-fluoro-4-methoxyphenyl)methanone, identified by its CAS number 844885-37-6, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety. The compound contains two aromatic rings: one substituted with two chlorine atoms at the 3 and 4 positions, and the other with a fluorine atom and a methoxy group at the corresponding positions. This substitution pattern contributes to its unique electronic properties and potential reactivity. The presence of halogens and a methoxy group can influence the compound's solubility, stability, and biological activity, making it of interest in various fields, including medicinal chemistry and material science. The compound's specific interactions and applications would depend on its molecular properties, including its polarity and potential for hydrogen bonding, which are influenced by the substituents on the aromatic rings. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C14H9Cl2FO2
InChI:InChI=1/C14H9Cl2FO2/c1-19-13-5-3-9(7-12(13)17)14(18)8-2-4-10(15)11(16)6-8/h2-7H,1H3
InChI key:InChIKey=VYCAMSCWZRHNNY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(OC)C=C1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- Gr Bg Dvr Cf Do1 [Wln]
- Methanone, (3,4-dichlorophenyl)(3-fluoro-4-methoxyphenyl)-
- (3,4-Dichlorophenyl)(3-fluoro-4-methoxyphenyl)methanone
- 3,4-DICHLORO-3'-FLUORO-4'-METHOXYBENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.