CAS 844885-38-7
:(3,4-Difluorophenyl)(3-methylphenyl)methanone
Description:
(3,4-Difluorophenyl)(3-methylphenyl)methanone, with the CAS number 844885-38-7, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the methanone moiety. This compound features a phenyl ring substituted with two fluorine atoms at the 3 and 4 positions, contributing to its electronic properties and potentially influencing its reactivity and interactions. Additionally, it has a 3-methylphenyl group, which adds steric bulk and can affect the compound's solubility and overall stability. The presence of fluorine atoms typically enhances lipophilicity and can impact the compound's biological activity, making it of interest in medicinal chemistry. The molecular structure suggests that it may exhibit interesting physical properties, such as melting and boiling points, which are influenced by the substituents on the aromatic rings. Overall, this compound may be explored for various applications, including pharmaceuticals and agrochemicals, due to its unique structural features.
Formula:C14H10F2O
InChI:InChI=1S/C14H10F2O/c1-9-3-2-4-10(7-9)14(17)11-5-6-12(15)13(16)8-11/h2-8H,1H3
InChI key:InChIKey=TZPCVKVITUAADB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C=C1)C2=CC(C)=CC=C2
Synonyms:- Methanone, (3,4-difluorophenyl)(3-methylphenyl)-
- (3,4-Difluorophenyl)(3-methylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.