CAS 844891-16-3
:3-[5-(2,4-Difluorophenyl)-2-furanyl]-2-propenoic acid
Description:
3-[5-(2,4-Difluorophenyl)-2-furanyl]-2-propenoic acid, with the CAS number 844891-16-3, is an organic compound characterized by its unique structure that includes a propenoic acid moiety and a furanyl group substituted with a difluorophenyl ring. This compound typically exhibits properties associated with both aromatic and unsaturated carboxylic acids, such as potential reactivity in electrophilic substitution and the ability to form hydrogen bonds due to the carboxylic acid functional group. The presence of the difluorophenyl substituent may influence its electronic properties, enhancing lipophilicity and potentially affecting its biological activity. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, and may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would involve standard organic reactions, and it may be of interest in the development of new therapeutic agents or materials.
Formula:C13H8F2O3
InChI:InChI=1S/C13H8F2O3/c14-8-1-4-10(11(15)7-8)12-5-2-9(18-12)3-6-13(16)17/h1-7H,(H,16,17)
InChI key:InChIKey=PUFRUEMJSQVGSX-UHFFFAOYSA-N
SMILES:FC1=C(C=2OC(C=CC(O)=O)=CC2)C=CC(F)=C1
Synonyms:- 2-Propenoic acid, 3-[5-(2,4-difluorophenyl)-2-furanyl]-
- 3-[5-(2,4-Difluorophenyl)-2-Furyl]Acrylic Acid
- 3-[5-(2,4-Difluorophenyl)-2-furanyl]-2-propenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.