CAS 84496-85-5

2-(2,4-dichloro-3-methylphenoxy)propanoic acid

Description:

2-(2,4-Dichloro-3-methylphenoxy)propanoic acid, commonly known as a herbicide, is characterized by its chemical structure that includes a propanoic acid moiety linked to a phenoxy group substituted with dichloro and methyl groups. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, while exhibiting limited solubility in water. It functions primarily as a selective herbicide, targeting specific plant species while minimizing damage to others, making it valuable in agricultural applications. The presence of chlorine atoms in its structure enhances its herbicidal activity and stability. Additionally, it may exhibit moderate to low toxicity to non-target organisms, necessitating careful handling and application. Its mode of action generally involves the disruption of plant growth processes, particularly affecting auxin transport. As with many chemical substances, proper safety measures should be observed when handling this compound to mitigate any potential environmental or health risks.

Formula: C₁₀H₁₀Cl₂O₃

InChI: InChI=1/C10H10Cl2O3/c1-5-7(11)3-4-8(9(5)12)15-6(2)10(13)14/h3-4,6H,1-2H3,(H,13,14)

SMILES: Cc1c(ccc(c1Cl)OC(C)C(=O)O)Cl

Synonyms:

• Propanoic Acid, 2-(2,4-Dichloro-3-Methylphenoxy)-

Clomeprop (free acid)

Controlled Product

CAS: 84496-85-5

Formula: C₁₀H₁₀Cl₂O₃

Color and Shape: Neat

Molecular weight: 249.09

Ref: 04-C11686100

Clomeprop (free acid)

CAS: 84496-85-5

Clomeprop (free acid) is a selective herbicide, which is synthesized chemically to target grass species. Its mode of action involves the inhibition of the enzyme acetyl-CoA carboxylase, crucial for fatty acid synthesis. This interferes with lipid production, which is vital for plant growth and development.

Formula: C₁₀H₁₀Cl₂O₃

Purity: Min. 95%

Molecular weight: 249.09 g/mol

Ref: 3D-JDA49685