CymitQuimica logo

CAS 84499-63-8

:

2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-aminopropanoate hydrochloride

Description:
2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-aminopropanoate hydrochloride, with CAS number 84499-63-8, is a chemical compound that features a purine derivative structure, which is significant in biochemistry due to its role in nucleic acids. This compound is characterized by the presence of an amino group, a methoxy group, and an ester functional group, contributing to its potential biological activity. It is typically a white to off-white crystalline solid, soluble in water, which is a common trait for many amino acid derivatives. The hydrochloride form indicates that it is a salt, enhancing its stability and solubility in aqueous solutions. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or as a biochemical probe in research. Its specific interactions and applications would depend on its reactivity and the biological systems it is tested in, making it of interest in medicinal chemistry and drug development.
Formula:C11H17ClN6O4
InChI:InChI=1/C11H16N6O4.ClH/c1-6(12)10(19)21-3-2-20-5-17-4-14-7-8(17)15-11(13)16-9(7)18;/h4,6H,2-3,5,12H2,1H3,(H3,13,15,16,18);1H/t6-;/m0./s1
SMILES:C[C@@H](C(=O)OCCOCn1cnc2c1[nH]c(=N)nc2O)N.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.