
CAS 845-52-3
:N2,N4-Bis(3-methoxypropyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine
Description:
N2,N4-Bis(3-methoxypropyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine, with CAS number 845-52-3, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features two 3-methoxypropyl groups and a methylthio substituent, contributing to its unique chemical properties. It is typically used in agricultural applications, particularly as a herbicide or plant growth regulator, due to its ability to inhibit specific biochemical pathways in plants. The presence of methoxy and methylthio groups enhances its solubility and bioactivity. In terms of physical properties, it is generally a solid at room temperature, with moderate stability under standard conditions. Its reactivity may vary depending on environmental factors, and it is important to handle it with care, following appropriate safety guidelines due to potential toxicity. Overall, this compound exemplifies the diverse applications of triazine derivatives in chemistry and agriculture.
Formula:C12H23N5O2S
InChI:InChI=1S/C12H23N5O2S/c1-18-8-4-6-13-10-15-11(14-7-5-9-19-2)17-12(16-10)20-3/h4-9H2,1-3H3,(H2,13,14,15,16,17)
InChI key:InChIKey=FBMDQVBGIYSDTI-UHFFFAOYSA-N
SMILES:N(CCCOC)C=1N=C(NCCCOC)N=C(SC)N1
Synonyms:- 1,3,5-Triazine-2,4-diamine, N,N′-bis(3-methoxypropyl)-6-(methylthio)-
- 2,4-Bis(3-methoxypropylamino)-6-(methylthio)-s-triazine
- N2,N4-Bis(3-methoxypropyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine
- 1,3,5-Triazine-2,4-diamine, N2,N4-bis(3-methoxypropyl)-6-(methylthio)-
- s-Triazine, 2,4-bis[(3-methoxypropyl)amino]-6-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
