CAS 845-64-7
:difluoro(triphenyl)-lambda~5~-phosphane
Description:
Difluoro(triphenyl)-lambda^5-phosphane, with the CAS number 845-64-7, is a phosphorous-containing compound characterized by the presence of a phosphorus atom bonded to two fluorine atoms and three phenyl groups. This compound belongs to the class of organophosphorus compounds, which are known for their diverse applications in organic synthesis and materials science. The presence of fluorine atoms imparts unique electronic properties, enhancing the compound's reactivity and stability under certain conditions. The triphenyl groups contribute to the steric bulk and can influence the compound's solubility and interaction with other molecules. Typically, difluoro(triphenyl)-lambda^5-phosphane exhibits a relatively high thermal stability, making it suitable for various chemical reactions, including those in coordination chemistry. Its unique structure allows it to act as a ligand in metal complexes, potentially facilitating catalysis or other chemical transformations. Overall, this compound is of interest in both academic research and industrial applications due to its distinctive properties and versatility in chemical reactions.
Formula:C18H15F2P
InChI:InChI=1/C18H15F2P/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
SMILES:c1ccc(cc1)P(c1ccccc1)(c1ccccc1)(F)F
Synonyms:- Difluorotriphenylphosphorane
- Phosphorane, difluorotriphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.