CAS 84501-65-5

3,4,5-Trichloro-2-hydroxybenzoic acid

Description:

3,4,5-Trichloro-2-hydroxybenzoic acid, with the CAS number 84501-65-5, is an organic compound that belongs to the class of chlorinated phenolic acids. It features a benzene ring substituted with three chlorine atoms at the 3, 4, and 5 positions and a hydroxyl group at the 2 position, contributing to its acidic properties. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic chlorinated structure. It exhibits strong acidity, which is characteristic of carboxylic acids, and can participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of multiple chlorine atoms enhances its reactivity and potential applications in agrochemicals and pharmaceuticals. Additionally, its structural features may impart biological activity, making it of interest in research related to environmental chemistry and toxicology. Proper handling and safety measures are essential due to the potential hazards associated with chlorinated compounds.

Formula: C₇H₃Cl₃O₃

InChI: InChI=1S/C7H3Cl3O3/c8-3-1-2(7(12)13)6(11)5(10)4(3)9/h1,11H,(H,12,13)

InChI key: InChIKey=LTBFHRWFTNPESC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(O)C(Cl)=C(Cl)C(Cl)=C1

Synonyms:

• 3,4,5-Trichlorosalicylic acid
• Benzoic acid, 3,4,5-trichloro-2-hydroxy-
• 3,4,5-Trichloro-2-hydroxybenzoic acid