CAS 84501-68-8
:Ethyl 4-[[1-[(4-fluorophenyl)methyl]-1H-benzimidazol-2-yl]amino]-1-piperidinecarboxylate
Description:
Ethyl 4-[[1-[(4-fluorophenyl)methyl]-1H-benzimidazol-2-yl]amino]-1-piperidinecarboxylate, identified by its CAS number 84501-68-8, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety and a piperidine ring. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with large, hydrophobic groups. The presence of a fluorine atom in the phenyl group may influence its electronic properties and biological activity, potentially enhancing lipophilicity and altering pharmacokinetics. Ethyl 4-[[1-[(4-fluorophenyl)methyl]-1H-benzimidazol-2-yl]amino]-1-piperidinecarboxylate is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization involve standard organic chemistry techniques, and it may exhibit interesting interactions with biological targets due to its unique structural features.
Formula:C22H25FN4O2
InChI:InChI=1S/C22H25FN4O2/c1-2-29-22(28)26-13-11-18(12-14-26)24-21-25-19-5-3-4-6-20(19)27(21)15-16-7-9-17(23)10-8-16/h3-10,18H,2,11-15H2,1H3,(H,24,25)
InChI key:InChIKey=MMPSFTZVUMTCKV-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1NC3CCN(C(OCC)=O)CC3)=CC=CC2)C4=CC=C(F)C=C4
Synonyms:- 1-Piperidinecarboxylic acid, 4-[[1-[(4-fluorophenyl)methyl]-1H-benzimidazol-2-yl]amino]-, ethyl ester
- Ethyl 4-[[1-[(4-fluorophenyl)methyl]-1H-benzimidazol-2-yl]amino]-1-piperidinecarboxylate
- ethyl 4-{[1-(4-fluorobenzyl)-1H-benzimidazol-2-yl]amino}piperidine-1-carboxylate
- Ethyl 4-((1-((4-fluorophenyl)methyl)-1H-benzimidazol-2-yl)amino)piperidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-Ethoxycarbonyl Norastemizole
CAS:Controlled ProductApplications Intermediate in the production of antihistamines
References Janssens, F., et al.: J. Med. Chem., 28, 1934 (1985), Martin, R., et al.: J. Med. Chem., 50, 6291 (2007),Formula:C22H25FN4O2Color and Shape:NeatMolecular weight:396.46


