CAS 84518-22-9

α,2,6,6-Tetramethyl-1-cyclohexene-1-butanal

Description:

α,2,6,6-Tetramethyl-1-cyclohexene-1-butanal, with the CAS number 84518-22-9, is an organic compound characterized by its unique structure that includes a cyclohexene ring and a butanal functional group. This compound features multiple methyl substituents, which contribute to its steric bulk and influence its reactivity and physical properties. Typically, such compounds exhibit a distinct odor, often associated with floral or fruity notes, making them of interest in the fragrance industry. The presence of the cyclohexene moiety suggests potential for reactivity in various chemical reactions, including electrophilic additions or polymerization. Additionally, the compound's structure may impart specific solubility characteristics, affecting its behavior in different solvents. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and light. Overall, α,2,6,6-Tetramethyl-1-cyclohexene-1-butanal is a complex molecule with applications in synthetic organic chemistry and potentially in the formulation of perfumes or flavoring agents.

Formula: C₁₄H₂₄O

InChI: InChI=1S/C14H24O/c1-11(10-15)7-8-13-12(2)6-5-9-14(13,3)4/h10-11H,5-9H2,1-4H3

InChI key: InChIKey=MXNVWZZDDFIWHW-UHFFFAOYSA-N

SMILES: C(CC(C=O)C)C=1C(C)(C)CCCC1C

Synonyms:

• 1-Cyclohexene-1-butanal, α,2,6,6-tetramethyl-
• 2-Methyl-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)butanal
• α,2,6,6-Tetramethyl-1-cyclohexene-1-butanal