CAS 84518-62-7
:2,5:3,4-dianhydro-D-altritol
Description:
2,5:3,4-Dianhydro-D-altritol, with the CAS number 84518-62-7, is a sugar alcohol derivative characterized by its unique anhydro structure, which results from the dehydration of D-altritol. This compound features two anhydro groups, contributing to its stability and distinct chemical properties. It is typically a white, crystalline solid that is soluble in water, reflecting its polyol nature. The presence of multiple hydroxyl groups allows for hydrogen bonding, influencing its solubility and reactivity. This compound is of interest in various fields, including organic synthesis and carbohydrate chemistry, due to its potential applications in the development of pharmaceuticals and as a building block for more complex molecules. Its structural characteristics also make it a candidate for studying carbohydrate metabolism and the synthesis of glycosides. Overall, 2,5:3,4-dianhydro-D-altritol exemplifies the intriguing chemistry of sugar derivatives and their functional applications in both biological and industrial contexts.
Formula:C6H10O4
InChI:InChI=1/C6H10O4/c7-1-3-5-6(10-5)4(2-8)9-3/h3-8H,1-2H2/t3-,4-,5-,6+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,5:3,4-Dianhydro-D-altritol
CAS:2,5:3,4-Dianhydro-D-altritol is a hydrogenated form of the sugar D-altritol. It can be prepared by hydrogenolysis of D-mannitol or D-sorbitol with palladium on charcoal at 200°C. The 2,5:3,4-dianhydro form can be converted to the 3,4-dianhydro form by hydrolysis with sodium hydroxide. Hydrogenation of the 3,4 form produces 2,5:3,4-dianhydro-D-altritol. This compound has been used in high energy density fuels and as a trackable marker for hydrogenolysis experiments. 2,5:3,4-Dianhydro-D-altritol is soluble in alcohols and extracted with ether in organic solvents such as acetone or chloroform. It oxidizes readily to the corresponding dPurity:Min. 95%
