CAS 84522-35-0

3-[(2,2-Dimethoxyethyl)thio]-1-propene

Description:

3-[(2,2-Dimethoxyethyl)thio]-1-propene, with the CAS number 84522-35-0, is an organic compound characterized by its unique structure that includes a propene backbone and a thioether functional group. This compound features a 2,2-dimethoxyethyl group attached to a sulfur atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the double bond in the propene structure allows for various chemical reactions, including polymerization and addition reactions. The thioether functionality can enhance solubility in organic solvents and may influence the compound's stability and reactivity. Typically, compounds like this may be used in the synthesis of more complex molecules, potentially serving as intermediates in pharmaceutical or agrochemical development. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as compounds with sulfur and double bonds can exhibit varying degrees of toxicity and reactivity.

Formula: C₇H₁₄O₂S

InChI: InChI=1S/C7H14O2S/c1-4-5-10-6-7(8-2)9-3/h4,7H,1,5-6H2,2-3H3

InChI key: InChIKey=JGGFJNSRWHKYOY-UHFFFAOYSA-N

SMILES: C(CSCC=C)(OC)OC

Synonyms:

• 1-Propene, 3-[(2,2-dimethoxyethyl)thio]-
• 3-[(2,2-Dimethoxyethyl)Sulfanyl]Prop-1-Ene
• 3-[(2,2-Dimethoxyethyl)thio]-1-propene
• 3-((2,2-Dimethoxyethyl)thio)propene

Altizide EP Impurity B

CAS: 84522-35-0

Formula: C₇H₁₄O₂S

Molecular weight: 162.25

Ref: ST-EA-CP-A102002