CymitQuimica logo

CAS 84525-73-5

:

Boron, [2-(1,3-dithian-2-ylmethyl)-6,6-dimethylbicyclo[3.1.1]hept-3-yl-C,S]dihydro-, [T-4-[1R-[1α,2β(1S*,2S*),3α,5α]]]-

Description:
The chemical substance with the name "Boron, [2-(1,3-dithian-2-ylmethyl)-6,6-dimethylbicyclo[3.1.1]hept-3-yl-C,S]dihydro-, [T-4-[1R-[1α,2β(1S*,2S*),3α,5α]]]" and CAS number 84525-73-5 is a boron-containing compound characterized by its complex bicyclic structure and the presence of a dithiane moiety. This compound features a boron atom that is likely coordinated to various organic groups, which can influence its reactivity and stability. The bicyclic framework suggests potential applications in organic synthesis or materials science, particularly in the development of boron-based catalysts or ligands. The presence of sulfur in the dithiane group may impart unique electronic properties, enhancing its utility in various chemical reactions. Additionally, the stereochemistry indicated by the specific descriptors suggests that the compound may exhibit chirality, which could be relevant in applications requiring enantioselectivity. Overall, this compound represents a specialized class of organoboron compounds with potential implications in both synthetic and applied chemistry.
Formula:C14H25BS2
InChI:InChI=1S/C14H25BS2/c1-14(2)9-6-11(14)10-8-13-16-4-3-5-17(13)15-12(10)7-9/h9-13H,3-8,15H2,1-2H3
InChI key:InChIKey=DSEIXROJCJXQIA-UHFFFAOYSA-N
SMILES:[H-][B+3]1([H-])[CH-]2C(C3C(C)(C)C(C2)C3)CC4[S]1CCCS4
Synonyms:
  • 1,3-Dithiane, boron deriv.
  • Boron, [2-(1,3-dithian-2-ylmethyl)-6,6-dimethylbicyclo[3.1.1]hept-3-yl-C,S]dihydro-, [T-4-[1R-[1α,2β(1S*,2S*),3α,5α]]]-
  • 1,3-Dithiane, 2-[(6,6-dimethylbicyclo[3.1.1]hept-2-yl)methyl]-, boron complex, [1R-(1α,2β,5α)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.