CAS 845252-03-1

(αS)-2,4-Difluoro-α-(trifluoromethyl)benzenemethanamine

Description:

(αS)-2,4-Difluoro-α-(trifluoromethyl)benzenemethanamine, with the CAS number 845252-03-1, is a chemical compound characterized by its unique fluorinated aromatic structure. This compound features a benzene ring substituted with two fluorine atoms at the 2 and 4 positions, and a trifluoromethyl group attached to the alpha carbon of the amine functional group. The presence of multiple fluorine atoms contributes to its lipophilicity and potential biological activity, making it of interest in pharmaceutical research. The specific stereochemistry indicated by the (αS) designation suggests that the compound has a defined spatial arrangement, which can significantly influence its reactivity and interaction with biological targets. Additionally, the amine group provides basic properties, allowing for potential interactions in various chemical environments. Overall, this compound's unique structure and properties may lend it utility in medicinal chemistry, particularly in the development of novel therapeutic agents.

Formula: C₈H₆F₅N

InChI: InChI=1S/C8H6F5N/c9-4-1-2-5(6(10)3-4)7(14)8(11,12)13/h1-3,7H,14H2/t7-/m0/s1

InChI key: InChIKey=LVSMZSSASNKGSY-ZETCQYMHSA-N

SMILES: [C@H](C(F)(F)F)(N)C1=C(F)C=C(F)C=C1

Synonyms:

• (αS)-2,4-Difluoro-α-(trifluoromethyl)benzenemethanamine
• Benzenemethanamine, 2,4-difluoro-α-(trifluoromethyl)-, (αS)-
• (1S)-1-(2,4-Difluorophenyl)-2,2,2-trifluoroethan-1-amine